C26H31ClF2N2O3 — CID 139530192
3-[(8aS)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]bicyclo[1.1.1]pentane-1-carboxylic acid (PubChem CID 139530192) has the molecular formula C26H31ClF2N2O3 and a molecular weight of 492.99 g/mol. Its IUPAC name is 3-[(8aS)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]bicyclo[1.1.1]pentane-1-carboxylic acid.
| Compound Name | 3-[(8aS)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
|---|---|
| PubChem CID | 139530192 |
| Molecular Formula | C26H31ClF2N2O3 |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 3-[(8aS)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| SMILES | CC(C)(C)CCc1ccc([C@@]23CCC(F)(F)CC2=CN(C24CC(C(=O)O)(C2)C4)C(=O)N3)cc1Cl |
| InChI | InChI=1S/C26H31ClF2N2O3/c1-22(2,3)7-6-16-4-5-17(10-19(16)27)26-9-8-25(28,29)11-18(26)12-31(21(34)30-26)24-13-23(14-24,15-24)20(32)33/h4-5,10,12H,6-9,11,13-15H2,1-3H3,(H,30,34)(H,32,33)/t23?,24?,26-/m0/s1 |
| InChIKey | VSQITGGZKHVHJX-RSMFLLDRSA-N |
| XLogP | 6.25 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |