C29H38ClNO3 — CID 162027937
3-[(7R,8R)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-7,8-dimethyl-3-oxo-5,6,7,8-tetrahydro-4H-isoquinolin-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid (PubChem CID 162027937) has the molecular formula C29H38ClNO3 and a molecular weight of 484.08 g/mol. Its IUPAC name is 3-[(7R,8R)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-7,8-dimethyl-3-oxo-5,6,7,8-tetrahydro-4H-isoquinolin-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid.
| Compound Name | 3-[(7R,8R)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-7,8-dimethyl-3-oxo-5,6,7,8-tetrahydro-4H-isoquinolin-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
|---|---|
| PubChem CID | 162027937 |
| Molecular Formula | C29H38ClNO3 |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3-[(7R,8R)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-7,8-dimethyl-3-oxo-5,6,7,8-tetrahydro-4H-isoquinolin-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| SMILES | C[C@@H]1CCC2(c3ccc(CCC(C)(C)C)c(Cl)c3)CC(=O)N(C34CC(C(=O)O)(C3)C4)C=C2[C@@H]1C |
| InChI | InChI=1S/C29H38ClNO3/c1-18-8-11-29(21-7-6-20(23(30)12-21)9-10-26(3,4)5)13-24(32)31(14-22(29)19(18)2)28-15-27(16-28,17-28)25(33)34/h6-7,12,14,18-19H,8-11,13,15-17H2,1-5H3,(H,33,34)/t18-,19-,27?,28?,29?/m1/s1 |
| InChIKey | YVQBXIVTQGHGMU-NXLREEMTSA-N |
| XLogP | 6.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |