C27H33ClF2N2O3 — CID 139548705
3-[(8aR)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]-2,3-dimethylcyclobutene-1-carboxylic acid (PubChem CID 139548705) has the molecular formula C27H33ClF2N2O3 and a molecular weight of 507.02 g/mol. Its IUPAC name is 3-[(8aR)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]-2,3-dimethylcyclobutene-1-carboxylic acid.
| Compound Name | 3-[(8aR)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]-2,3-dimethylcyclobutene-1-carboxylic acid |
|---|---|
| PubChem CID | 139548705 |
| Molecular Formula | C27H33ClF2N2O3 |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 3-[(8aR)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]-2,3-dimethylcyclobutene-1-carboxylic acid |
| SMILES | CC1=C(C(=O)O)CC1(C)N1C=C2CC(F)(F)CC[C@]2(c2ccc(CCC(C)(C)C)c(Cl)c2)NC1=O |
| InChI | InChI=1S/C27H33ClF2N2O3/c1-16-20(22(33)34)14-25(16,5)32-15-19-13-26(29,30)10-11-27(19,31-23(32)35)18-7-6-17(21(28)12-18)8-9-24(2,3)4/h6-7,12,15H,8-11,13-14H2,1-5H3,(H,31,35)(H,33,34)/t25?,27-/m1/s1 |
| InChIKey | TWXDIEYRRCQLSB-ZCJYOONXSA-N |
| XLogP | 6.81 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |