C25H35ClN2O3 — CID 139548735
3-[(8aS)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]propanoic acid (PubChem CID 139548735) has the molecular formula C25H35ClN2O3 and a molecular weight of 447.02 g/mol. Its IUPAC name is 3-[(8aS)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]propanoic acid.
| Compound Name | 3-[(8aS)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 139548735 |
| Molecular Formula | C25H35ClN2O3 |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-[(8aS)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinazolin-3-yl]propanoic acid |
| SMILES | CC(C)(C)CCc1ccc([C@@]23CCC(C)(C)CC2=CN(CCC(=O)O)C(=O)N3)cc1Cl |
| InChI | InChI=1S/C25H35ClN2O3/c1-23(2,3)10-8-17-6-7-18(14-20(17)26)25-12-11-24(4,5)15-19(25)16-28(22(31)27-25)13-9-21(29)30/h6-7,14,16H,8-13,15H2,1-5H3,(H,27,31)(H,29,30)/t25-/m0/s1 |
| InChIKey | DJIFOTXRYXJCCY-VWLOTQADSA-N |
| XLogP | 6.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |