C29H38ClN3O3 — CID 147668485
4-[8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6-cyano-2-oxo-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]-2,4-dimethylcyclopentane-1-carboxylic acid (PubChem CID 147668485) has the molecular formula C29H38ClN3O3 and a molecular weight of 512.09 g/mol. Its IUPAC name is 4-[8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6-cyano-2-oxo-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]-2,4-dimethylcyclopentane-1-carboxylic acid.
| Compound Name | 4-[8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6-cyano-2-oxo-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]-2,4-dimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 147668485 |
| Molecular Formula | C29H38ClN3O3 |
| Molecular Weight | 512.09 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 4-[8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6-cyano-2-oxo-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]-2,4-dimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1CC(C)(N2C=C3CC(C#N)CCC3(c3ccc(CCC(C)(C)C)c(Cl)c3)NC2=O)CC1C(=O)O |
| InChI | InChI=1S/C29H38ClN3O3/c1-18-14-28(5,15-23(18)25(34)35)33-17-22-12-19(16-31)8-11-29(22,32-26(33)36)21-7-6-20(24(30)13-21)9-10-27(2,3)4/h6-7,13,17-19,23H,8-12,14-15H2,1-5H3,(H,32,36)(H,34,35) |
| InChIKey | GMTQSYJKWANKGQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.09 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |