C27H56N6 — CID 160974780
2,7-bis[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]heptanimidamide (PubChem CID 160974780) has the molecular formula C27H56N6 and a molecular weight of 464.79 g/mol. Its IUPAC name is 2,7-bis[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]heptanimidamide.
| Compound Name | 2,7-bis[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]heptanimidamide |
|---|---|
| PubChem CID | 160974780 |
| Molecular Formula | C27H56N6 |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 464.46 |
| IUPAC Name | 2,7-bis[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]heptanimidamide |
| SMILES | [H]/N=C(\N)C(CCCCCN(C)C1CC(C)(C)NC(C)(C)C1)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H56N6/c1-24(2)16-20(17-25(3,4)30-24)32(9)15-13-11-12-14-22(23(28)29)33(10)21-18-26(5,6)31-27(7,8)19-21/h20-22,30-31H,11-19H2,1-10H3,(H3,28,29) |
| InChIKey | SYSGPQWGSAHJTP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|