C32H33BrCl2N4O2 — CID 160983677
5-(3-bromophenyl)-N-(5-chloro-2-pyridinyl)pentanamide;N-(5-chloro-2-pyridinyl)-5-phenylpentanamide (PubChem CID 160983677) has the molecular formula C32H33BrCl2N4O2 and a molecular weight of 656.45 g/mol. Its IUPAC name is 5-(3-bromophenyl)-N-(5-chloro-2-pyridinyl)pentanamide;N-(5-chloro-2-pyridinyl)-5-phenylpentanamide.
| Compound Name | 5-(3-bromophenyl)-N-(5-chloro-2-pyridinyl)pentanamide;N-(5-chloro-2-pyridinyl)-5-phenylpentanamide |
|---|---|
| PubChem CID | 160983677 |
| Molecular Formula | C32H33BrCl2N4O2 |
| Molecular Weight | 656.45 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | 5-(3-bromophenyl)-N-(5-chloro-2-pyridinyl)pentanamide;N-(5-chloro-2-pyridinyl)-5-phenylpentanamide |
| SMILES | O=C(CCCCc1cccc(Br)c1)Nc1ccc(Cl)cn1.O=C(CCCCc1ccccc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H16BrClN2O.C16H17ClN2O/c17-13-6-3-5-12(10-13)4-1-2-7-16(21)20-15-9-8-14(18)11-19-15;17-14-10-11-15(18-12-14)19-16(20)9-5-4-8-13-6-2-1-3-7-13/h3,5-6,8-11H,1-2,4,7H2,(H,19,20,21);1-3,6-7,10-12H,4-5,8-9H2,(H,18,19,20) |
| InChIKey | SZVKRHIQKIWKOF-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.45 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|