About methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate
methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate (PubChem CID 160985152) has the molecular formula C11H21NO6
and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate.
Molecular Properties
| Compound Name | methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate |
| PubChem CID | 160985152 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate |
| SMILES | CNCC(C)(O)C(=O)OC.COC(=O)C1(C)CO1 |
| InChI | InChI=1S/C6H13NO3.C5H8O3/c1-6(9,4-7-2)5(8)10-3;1-5(3-8-5)4(6)7-2/h7,9H,4H2,1-3H3;3H2,1-2H3 |
| InChIKey | TTWGOWDPSQEVHV-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate?
The IUPAC name of methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate (CID 160985152) is methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate.
What is the SMILES notation for methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate?
The canonical SMILES for methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate is CNCC(C)(O)C(=O)OC.COC(=O)C1(C)CO1.
What is the InChIKey of methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate?
The InChIKey is TTWGOWDPSQEVHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3.C5H8O3/c1-6(9,4-7-2)5(8)10-3;1-5(3-8-5)4(6)7-2/h7,9H,4H2,1-3H3;3H2,1-2H3.
What are the key properties of methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate?
methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate has a molecular weight of 263.29 g/mol, XLogP of -0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-2-methyl-3-(methylamino)propanoate;methyl 2-methyloxirane-2-carboxylate is sourced from PubChem (CID 160985152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).