C27H32F2N2O5 — CID 160990544
(E)-but-2-enedioic acid;N-(3-fluorophenyl)-N-[[1-[2-(3-fluorophenyl)ethyl]piperidin-4-yl]methyl]propanamide (PubChem CID 160990544) has the molecular formula C27H32F2N2O5 and a molecular weight of 502.56 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-(3-fluorophenyl)-N-[[1-[2-(3-fluorophenyl)ethyl]piperidin-4-yl]methyl]propanamide.
| Compound Name | (E)-but-2-enedioic acid;N-(3-fluorophenyl)-N-[[1-[2-(3-fluorophenyl)ethyl]piperidin-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 160990544 |
| Molecular Formula | C27H32F2N2O5 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | (E)-but-2-enedioic acid;N-(3-fluorophenyl)-N-[[1-[2-(3-fluorophenyl)ethyl]piperidin-4-yl]methyl]propanamide |
| SMILES | CCC(=O)N(CC1CCN(CCc2cccc(F)c2)CC1)c1cccc(F)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H28F2N2O.C4H4O4/c1-2-23(28)27(22-8-4-7-21(25)16-22)17-19-10-13-26(14-11-19)12-9-18-5-3-6-20(24)15-18;5-3(6)1-2-4(7)8/h3-8,15-16,19H,2,9-14,17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | TUOJCPIHMLWESZ-WLHGVMLRSA-N |
| XLogP | 4.37 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|