C36H61ClN8O10S2 — CID 160993006
tert-butyl N-(4-chlorosulfonylphenyl)carbamate;tert-butyl N-[4-[2-(4-methylpiperazin-1-yl)ethoxysulfamoyl]phenyl]carbamate;O-[2-(4-methylpiperazin-1-yl)ethyl]hydroxylamine (PubChem CID 160993006) has the molecular formula C36H61ClN8O10S2 and a molecular weight of 865.52 g/mol. Its IUPAC name is tert-butyl N-(4-chlorosulfonylphenyl)carbamate;tert-butyl N-[4-[2-(4-methylpiperazin-1-yl)ethoxysulfamoyl]phenyl]carbamate;O-[2-(4-methylpiperazin-1-yl)ethyl]hydroxylamine.
| Compound Name | tert-butyl N-(4-chlorosulfonylphenyl)carbamate;tert-butyl N-[4-[2-(4-methylpiperazin-1-yl)ethoxysulfamoyl]phenyl]carbamate;O-[2-(4-methylpiperazin-1-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 160993006 |
| Molecular Formula | C36H61ClN8O10S2 |
| Molecular Weight | 865.52 g/mol |
| Exact Mass | 864.36 |
| IUPAC Name | tert-butyl N-(4-chlorosulfonylphenyl)carbamate;tert-butyl N-[4-[2-(4-methylpiperazin-1-yl)ethoxysulfamoyl]phenyl]carbamate;O-[2-(4-methylpiperazin-1-yl)ethyl]hydroxylamine |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(S(=O)(=O)Cl)cc1.CN1CCN(CCON)CC1.CN1CCN(CCONS(=O)(=O)c2ccc(NC(=O)OC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H30N4O5S.C11H14ClNO4S.C7H17N3O/c1-18(2,3)27-17(23)19-15-5-7-16(8-6-15)28(24,25)20-26-14-13-22-11-9-21(4)10-12-22;1-11(2,3)17-10(14)13-8-4-6-9(7-5-8)18(12,15)16;1-9-2-4-10(5-3-9)6-7-11-8/h5-8,20H,9-14H2,1-4H3,(H,19,23);4-7H,1-3H3,(H,13,14);2-8H2,1H3 |
| InChIKey | TUWSJHYDPSFWEK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 214.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|