C14H22N4O5S — CID 146223454
[4-[2-(4-methylpiperazin-1-yl)ethoxysulfamoyl]phenyl]carbamic acid (PubChem CID 146223454) has the molecular formula C14H22N4O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is [4-[2-(4-methylpiperazin-1-yl)ethoxysulfamoyl]phenyl]carbamic acid.
| Compound Name | [4-[2-(4-methylpiperazin-1-yl)ethoxysulfamoyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 146223454 |
| Molecular Formula | C14H22N4O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [4-[2-(4-methylpiperazin-1-yl)ethoxysulfamoyl]phenyl]carbamic acid |
| SMILES | CN1CCN(CCONS(=O)(=O)c2ccc(NC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C14H22N4O5S/c1-17-6-8-18(9-7-17)10-11-23-16-24(21,22)13-4-2-12(3-5-13)15-14(19)20/h2-5,15-16H,6-11H2,1H3,(H,19,20) |
| InChIKey | OCKKIRBQKHMMBF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|