C9H22N2O3 — CID 160993884
(2R,3S,4S,5R)-2,5-bis(2-aminoethyl)oxolane-3,4-diol;methane (PubChem CID 160993884) has the molecular formula C9H22N2O3 and a molecular weight of 206.29 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-bis(2-aminoethyl)oxolane-3,4-diol;methane.
| Compound Name | (2R,3S,4S,5R)-2,5-bis(2-aminoethyl)oxolane-3,4-diol;methane |
|---|---|
| PubChem CID | 160993884 |
| Molecular Formula | C9H22N2O3 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-bis(2-aminoethyl)oxolane-3,4-diol;methane |
| SMILES | C.NCC[C@H]1O[C@H](CCN)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H18N2O3.CH4/c9-3-1-5-7(11)8(12)6(13-5)2-4-10;/h5-8,11-12H,1-4,9-10H2;1H4/t5-,6-,7-,8-;/m1./s1 |
| InChIKey | TUZIHGDEOREQRE-XNJRRJNCSA-N |
| XLogP | -1.19 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |