C12H18O10 — CID 160994121
4,5-dimethyl-1,3-dioxolan-2-one;(5-ethylperoxy-2-oxo-1,3-dioxolan-4-yl) acetate (PubChem CID 160994121) has the molecular formula C12H18O10 and a molecular weight of 322.27 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-dioxolan-2-one;(5-ethylperoxy-2-oxo-1,3-dioxolan-4-yl) acetate.
| Compound Name | 4,5-dimethyl-1,3-dioxolan-2-one;(5-ethylperoxy-2-oxo-1,3-dioxolan-4-yl) acetate |
|---|---|
| PubChem CID | 160994121 |
| Molecular Formula | C12H18O10 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4,5-dimethyl-1,3-dioxolan-2-one;(5-ethylperoxy-2-oxo-1,3-dioxolan-4-yl) acetate |
| SMILES | CC1OC(=O)OC1C.CCOOC1OC(=O)OC1OC(C)=O |
| InChI | InChI=1S/C7H10O7.C5H8O3/c1-3-10-14-6-5(11-4(2)8)12-7(9)13-6;1-3-4(2)8-5(6)7-3/h5-6H,3H2,1-2H3;3-4H,1-2H3 |
| InChIKey | TVACOAGVXSNABD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|