C8H12F2O4 — CID 126585094
[(3S,5R)-5-ethyl-4,4-difluoro-3-hydroxyoxolan-2-yl] acetate (PubChem CID 126585094) has the molecular formula C8H12F2O4 and a molecular weight of 210.18 g/mol. Its IUPAC name is [(3S,5R)-5-ethyl-4,4-difluoro-3-hydroxyoxolan-2-yl] acetate.
| Compound Name | [(3S,5R)-5-ethyl-4,4-difluoro-3-hydroxyoxolan-2-yl] acetate |
|---|---|
| PubChem CID | 126585094 |
| Molecular Formula | C8H12F2O4 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | [(3S,5R)-5-ethyl-4,4-difluoro-3-hydroxyoxolan-2-yl] acetate |
| SMILES | CC[C@H]1OC(OC(C)=O)[C@H](O)C1(F)F |
| InChI | InChI=1S/C8H12F2O4/c1-3-5-8(9,10)6(12)7(14-5)13-4(2)11/h5-7,12H,3H2,1-2H3/t5-,6+,7?/m1/s1 |
| InChIKey | TXNJTVKUOFJYIS-JEAXJGTLSA-N |
| XLogP | 0.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |