C9H13IO5 — CID 10426610
ethyl 2-iodo-2-[(4R,5S)-5-methyl-2-oxo-1,3-dioxolan-4-yl]propanoate (PubChem CID 10426610) has the molecular formula C9H13IO5 and a molecular weight of 328.10 g/mol. Its IUPAC name is ethyl 2-iodo-2-[(4R,5S)-5-methyl-2-oxo-1,3-dioxolan-4-yl]propanoate.
| Compound Name | ethyl 2-iodo-2-[(4R,5S)-5-methyl-2-oxo-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 10426610 |
| Molecular Formula | C9H13IO5 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | ethyl 2-iodo-2-[(4R,5S)-5-methyl-2-oxo-1,3-dioxolan-4-yl]propanoate |
| SMILES | CCOC(=O)C(C)(I)[C@@H]1OC(=O)O[C@H]1C |
| InChI | InChI=1S/C9H13IO5/c1-4-13-7(11)9(3,10)6-5(2)14-8(12)15-6/h5-6H,4H2,1-3H3/t5-,6+,9?/m0/s1 |
| InChIKey | NHNQKOJKQYGBTR-NSYCXJRNSA-N |
| XLogP | 1.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|