C12H14Cl2O6 — CID 11324806
diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-methylpropanedioate (PubChem CID 11324806) has the molecular formula C12H14Cl2O6 and a molecular weight of 325.14 g/mol. Its IUPAC name is diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-methylpropanedioate.
| Compound Name | diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-methylpropanedioate |
|---|---|
| PubChem CID | 11324806 |
| Molecular Formula | C12H14Cl2O6 |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)C1OC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C12H14Cl2O6/c1-4-18-10(16)12(3,11(17)19-5-2)8-6(13)7(14)9(15)20-8/h8H,4-5H2,1-3H3 |
| InChIKey | AAIGMGWNWHNQLP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|