C13H16Cl2O6 — CID 11348353
dipropan-2-yl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanedioate (PubChem CID 11348353) has the molecular formula C13H16Cl2O6 and a molecular weight of 339.17 g/mol. Its IUPAC name is dipropan-2-yl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanedioate.
| Compound Name | dipropan-2-yl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanedioate |
|---|---|
| PubChem CID | 11348353 |
| Molecular Formula | C13H16Cl2O6 |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | dipropan-2-yl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanedioate |
| SMILES | CC(C)OC(=O)C(C(=O)OC(C)C)C1OC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C13H16Cl2O6/c1-5(2)19-11(16)7(12(17)20-6(3)4)10-8(14)9(15)13(18)21-10/h5-7,10H,1-4H3 |
| InChIKey | IMMCQUKQAUQXDG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|