C11H12Cl2O6 — CID 11370337
diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanedioate (PubChem CID 11370337) has the molecular formula C11H12Cl2O6 and a molecular weight of 311.12 g/mol. Its IUPAC name is diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanedioate.
| Compound Name | diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanedioate |
|---|---|
| PubChem CID | 11370337 |
| Molecular Formula | C11H12Cl2O6 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | diethyl 2-(3,4-dichloro-5-oxo-2H-furan-2-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1OC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C11H12Cl2O6/c1-3-17-9(14)5(10(15)18-4-2)8-6(12)7(13)11(16)19-8/h5,8H,3-4H2,1-2H3 |
| InChIKey | FLLAGVPRNUGABW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|