C9H17NO3 — CID 161005757
1-[(2S,5R)-5-aminooxan-2-yl]-4-hydroxybutan-1-one (PubChem CID 161005757) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-[(2S,5R)-5-aminooxan-2-yl]-4-hydroxybutan-1-one.
| Compound Name | 1-[(2S,5R)-5-aminooxan-2-yl]-4-hydroxybutan-1-one |
|---|---|
| PubChem CID | 161005757 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 1-[(2S,5R)-5-aminooxan-2-yl]-4-hydroxybutan-1-one |
| SMILES | N[C@@H]1CC[C@@H](C(=O)CCCO)OC1 |
| InChI | InChI=1S/C9H17NO3/c10-7-3-4-9(13-6-7)8(12)2-1-5-11/h7,9,11H,1-6,10H2/t7-,9+/m1/s1 |
| InChIKey | GWGXCPKCRMFSNP-APPZFPTMSA-N |
| XLogP | -0.17 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |