C36H36N6O5 — CID 161009608
5-[[2-[4-(4-hydroxypiperidin-1-yl)butanoylamino]-4-pyridinyl]oxy]-N-phenylindole-1-carboxamide;isocyanatobenzene (PubChem CID 161009608) has the molecular formula C36H36N6O5 and a molecular weight of 632.72 g/mol. Its IUPAC name is 5-[[2-[4-(4-hydroxypiperidin-1-yl)butanoylamino]-4-pyridinyl]oxy]-N-phenylindole-1-carboxamide;isocyanatobenzene.
| Compound Name | 5-[[2-[4-(4-hydroxypiperidin-1-yl)butanoylamino]-4-pyridinyl]oxy]-N-phenylindole-1-carboxamide;isocyanatobenzene |
|---|---|
| PubChem CID | 161009608 |
| Molecular Formula | C36H36N6O5 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 5-[[2-[4-(4-hydroxypiperidin-1-yl)butanoylamino]-4-pyridinyl]oxy]-N-phenylindole-1-carboxamide;isocyanatobenzene |
| SMILES | O=C(CCCN1CCC(O)CC1)Nc1cc(Oc2ccc3c(ccn3C(=O)Nc3ccccc3)c2)ccn1.O=C=Nc1ccccc1 |
| InChI | InChI=1S/C29H31N5O4.C7H5NO/c35-23-12-16-33(17-13-23)15-4-7-28(36)32-27-20-25(10-14-30-27)38-24-8-9-26-21(19-24)11-18-34(26)29(37)31-22-5-2-1-3-6-22;9-6-8-7-4-2-1-3-5-7/h1-3,5-6,8-11,14,18-20,23,35H,4,7,12-13,15-17H2,(H,31,37)(H,30,32,36);1-5H |
| InChIKey | TWYOXKCFHLYDDJ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|