C54H77BrN4O4 — CID 161012704
(3-bromo-1-phenylpropyl)benzene;tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate;tert-butyl 4-[2-(3,3-diphenylpropylamino)ethyl]piperidine-1-carboxylate (PubChem CID 161012704) has the molecular formula C54H77BrN4O4 and a molecular weight of 926.14 g/mol. Its IUPAC name is (3-bromo-1-phenylpropyl)benzene;tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate;tert-butyl 4-[2-(3,3-diphenylpropylamino)ethyl]piperidine-1-carboxylate.
| Compound Name | (3-bromo-1-phenylpropyl)benzene;tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate;tert-butyl 4-[2-(3,3-diphenylpropylamino)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161012704 |
| Molecular Formula | C54H77BrN4O4 |
| Molecular Weight | 926.14 g/mol |
| Exact Mass | 924.51 |
| IUPAC Name | (3-bromo-1-phenylpropyl)benzene;tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate;tert-butyl 4-[2-(3,3-diphenylpropylamino)ethyl]piperidine-1-carboxylate |
| SMILES | BrCCC(c1ccccc1)c1ccccc1.CC(C)(C)OC(=O)N1CCC(CCN)CC1.CC(C)(C)OC(=O)N1CCC(CCNCCC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H38N2O2.C15H15Br.C12H24N2O2/c1-27(2,3)31-26(30)29-20-16-22(17-21-29)14-18-28-19-15-25(23-10-6-4-7-11-23)24-12-8-5-9-13-24;16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-12(2,3)16-11(15)14-8-5-10(4-7-13)6-9-14/h4-13,22,25,28H,14-21H2,1-3H3;1-10,15H,11-12H2;10H,4-9,13H2,1-3H3 |
| InChIKey | TXIIXYXYPHRXCZ-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.14 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|