C37H47N3O2 — CID 155124169
tert-butyl 4-[2-[[3-(1-benzylindol-3-yl)-3-(3-methylphenyl)propyl]amino]ethyl]piperidine-1-carboxylate (PubChem CID 155124169) has the molecular formula C37H47N3O2 and a molecular weight of 565.80 g/mol. Its IUPAC name is tert-butyl 4-[2-[[3-(1-benzylindol-3-yl)-3-(3-methylphenyl)propyl]amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[3-(1-benzylindol-3-yl)-3-(3-methylphenyl)propyl]amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155124169 |
| Molecular Formula | C37H47N3O2 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | tert-butyl 4-[2-[[3-(1-benzylindol-3-yl)-3-(3-methylphenyl)propyl]amino]ethyl]piperidine-1-carboxylate |
| SMILES | Cc1cccc(C(CCNCCC2CCN(C(=O)OC(C)(C)C)CC2)c2cn(Cc3ccccc3)c3ccccc23)c1 |
| InChI | InChI=1S/C37H47N3O2/c1-28-11-10-14-31(25-28)32(18-22-38-21-17-29-19-23-39(24-20-29)36(41)42-37(2,3)4)34-27-40(26-30-12-6-5-7-13-30)35-16-9-8-15-33(34)35/h5-16,25,27,29,32,38H,17-24,26H2,1-4H3 |
| InChIKey | HQXQIWLWHBTZRK-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|