C27H34FN3O6S2 — CID 161039729
(7R,16E,21R)-7-[(4-fluorophenyl)methyl]-21-propan-2-yl-2-oxa-12,13-dithia-5,8,23-triazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone (PubChem CID 161039729) has the molecular formula C27H34FN3O6S2 and a molecular weight of 579.72 g/mol. Its IUPAC name is (7R,16E,21R)-7-[(4-fluorophenyl)methyl]-21-propan-2-yl-2-oxa-12,13-dithia-5,8,23-triazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone.
| Compound Name | (7R,16E,21R)-7-[(4-fluorophenyl)methyl]-21-propan-2-yl-2-oxa-12,13-dithia-5,8,23-triazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 161039729 |
| Molecular Formula | C27H34FN3O6S2 |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | (7R,16E,21R)-7-[(4-fluorophenyl)methyl]-21-propan-2-yl-2-oxa-12,13-dithia-5,8,23-triazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
| SMILES | CC(C)[C@H]1CC(=O)CC2/C=C/CCSSCC(NC1=O)C(=O)N[C@H](Cc1ccc(F)cc1)C(=O)NCC(=O)O2 |
| InChI | InChI=1S/C27H34FN3O6S2/c1-16(2)21-13-19(32)12-20-5-3-4-10-38-39-15-23(31-25(21)34)27(36)30-22(26(35)29-14-24(33)37-20)11-17-6-8-18(28)9-7-17/h3,5-9,16,20-23H,4,10-15H2,1-2H3,(H,29,35)(H,30,36)(H,31,34)/b5-3+/t20?,21-,22-,23?/m1/s1 |
| InChIKey | UASLOXADPCYXCJ-AVEYCIFXSA-N |
| XLogP | 2.34 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|