C14H30O — CID 161043827
2,3-dimethyl-2-propan-2-yloxirane;2,3-dimethyl-4-tritiopentane (PubChem CID 161043827) has the molecular formula C14H30O and a molecular weight of 216.40 g/mol. Its IUPAC name is 2,3-dimethyl-2-propan-2-yloxirane;2,3-dimethyl-4-tritiopentane.
| Compound Name | 2,3-dimethyl-2-propan-2-yloxirane;2,3-dimethyl-4-tritiopentane |
|---|---|
| PubChem CID | 161043827 |
| Molecular Formula | C14H30O |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.24 |
| IUPAC Name | 2,3-dimethyl-2-propan-2-yloxirane;2,3-dimethyl-4-tritiopentane |
| SMILES | CC(C)C1(C)OC1C.[3H]C(C)C(C)C(C)C |
| InChI | InChI=1S/C7H14O.C7H16/c1-5(2)7(4)6(3)8-7;1-5-7(4)6(2)3/h5-6H,1-4H3;6-7H,5H2,1-4H3/i;5T |
| InChIKey | UBFUSYLGFYDPCN-YLKHFKOSSA-N |
| XLogP | 4.51 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|