C14H28O — CID 58591824
(2R,4R)-2,3,4-triethyl-2,3,4,5-tetramethyloxolane (PubChem CID 58591824) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is (2R,4R)-2,3,4-triethyl-2,3,4,5-tetramethyloxolane.
| Compound Name | (2R,4R)-2,3,4-triethyl-2,3,4,5-tetramethyloxolane |
|---|---|
| PubChem CID | 58591824 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (2R,4R)-2,3,4-triethyl-2,3,4,5-tetramethyloxolane |
| SMILES | CCC1(C)[C@@](C)(CC)OC(C)[C@]1(C)CC |
| InChI | InChI=1S/C14H28O/c1-8-12(5)11(4)15-14(7,10-3)13(12,6)9-2/h11H,8-10H2,1-7H3/t11?,12-,13?,14+/m0/s1 |
| InChIKey | WTCUOUPVSHLQFM-GNRIBBGQSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |