About N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine
N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine (PubChem CID 23268450) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine |
| PubChem CID | 23268450 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine |
| SMILES | CC(NCc1ccccc1)C1(C)OC1C |
| InChI | InChI=1S/C13H19NO/c1-10(13(3)11(2)15-13)14-9-12-7-5-4-6-8-12/h4-8,10-11,14H,9H2,1-3H3 |
| InChIKey | ZERDHNJLFYHUSZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine?
The IUPAC name of N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine (CID 23268450) is N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine.
What is the SMILES notation for N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine?
The canonical SMILES for N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine is CC(NCc1ccccc1)C1(C)OC1C.
What is the InChIKey of N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine?
The InChIKey is ZERDHNJLFYHUSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-10(13(3)11(2)15-13)14-9-12-7-5-4-6-8-12/h4-8,10-11,14H,9H2,1-3H3.
What are the key properties of N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine?
N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine has a molecular weight of 205.30 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-(2,3-dimethyloxiran-2-yl)ethanamine is sourced from PubChem (CID 23268450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).