About 3-ethyl-3-methyloxane;methane
3-ethyl-3-methyloxane;methane (PubChem CID 161043883) has the molecular formula C9H20O
and a molecular weight of 144.26 g/mol. Its IUPAC name is 3-ethyl-3-methyloxane;methane.
Molecular Properties
| Compound Name | 3-ethyl-3-methyloxane;methane |
| PubChem CID | 161043883 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | 3-ethyl-3-methyloxane;methane |
| SMILES | C.CCC1(C)CCCOC1 |
| InChI | InChI=1S/C8H16O.CH4/c1-3-8(2)5-4-6-9-7-8;/h3-7H2,1-2H3;1H4 |
| InChIKey | UBFYMIIFUNDDSS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-3-methyloxane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-methyloxane;methane?
The IUPAC name of 3-ethyl-3-methyloxane;methane (CID 161043883) is 3-ethyl-3-methyloxane;methane.
What is the SMILES notation for 3-ethyl-3-methyloxane;methane?
The canonical SMILES for 3-ethyl-3-methyloxane;methane is C.CCC1(C)CCCOC1.
What is the InChIKey of 3-ethyl-3-methyloxane;methane?
The InChIKey is UBFYMIIFUNDDSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.CH4/c1-3-8(2)5-4-6-9-7-8;/h3-7H2,1-2H3;1H4.
What are the key properties of 3-ethyl-3-methyloxane;methane?
3-ethyl-3-methyloxane;methane has a molecular weight of 144.26 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-methyloxane;methane is sourced from PubChem (CID 161043883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).