C33H24ClF3N4O5 — CID 161044372
2-[2-[5-chloro-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]-2-oxo-1-pyridinyl]-2-(3,4,5-trifluorophenyl)ethoxy]isoindole-1,3-dione (PubChem CID 161044372) has the molecular formula C33H24ClF3N4O5 and a molecular weight of 649.03 g/mol. Its IUPAC name is 2-[2-[5-chloro-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]-2-oxo-1-pyridinyl]-2-(3,4,5-trifluorophenyl)ethoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-[5-chloro-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]-2-oxo-1-pyridinyl]-2-(3,4,5-trifluorophenyl)ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 161044372 |
| Molecular Formula | C33H24ClF3N4O5 |
| Molecular Weight | 649.03 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | 2-[2-[5-chloro-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methyl]-2-oxo-1-pyridinyl]-2-(3,4,5-trifluorophenyl)ethoxy]isoindole-1,3-dione |
| SMILES | COc1cc(Cc2cc(Cl)cn(C(CON3C(=O)c4ccccc4C3=O)c3cc(F)c(F)c(F)c3)c2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C33H24ClF3N4O5/c1-18-14-39(17-38-18)27-8-7-19(10-29(27)45-2)9-21-11-22(34)15-40(31(21)42)28(20-12-25(35)30(37)26(36)13-20)16-46-41-32(43)23-5-3-4-6-24(23)33(41)44/h3-8,10-15,17,28H,9,16H2,1-2H3 |
| InChIKey | ACRHDNQWQYGAGH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 95.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.03 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|