C32H40N2O5 — CID 161047044
7-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-N-butyl-2,2-bis(ethoxymethyl)-3,7-dioxoheptanamide (PubChem CID 161047044) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is 7-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-N-butyl-2,2-bis(ethoxymethyl)-3,7-dioxoheptanamide.
| Compound Name | 7-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-N-butyl-2,2-bis(ethoxymethyl)-3,7-dioxoheptanamide |
|---|---|
| PubChem CID | 161047044 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 7-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-N-butyl-2,2-bis(ethoxymethyl)-3,7-dioxoheptanamide |
| SMILES | CCCCNC(=O)C(COCC)(COCC)C(=O)CCCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C32H40N2O5/c1-4-7-21-33-31(37)32(23-38-5-2,24-39-6-3)29(35)17-12-18-30(36)34-22-27-15-9-8-13-25(27)19-20-26-14-10-11-16-28(26)34/h8-11,13-16H,4-7,12,17-18,21-24H2,1-3H3,(H,33,37) |
| InChIKey | UBQCVOSGAAXDGO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|