C23H24NO3P — CID 162128892
1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)heptane-1,6-dione;phosphorosomethane (PubChem CID 162128892) has the molecular formula C23H24NO3P and a molecular weight of 393.42 g/mol. Its IUPAC name is 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)heptane-1,6-dione;phosphorosomethane.
| Compound Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)heptane-1,6-dione;phosphorosomethane |
|---|---|
| PubChem CID | 162128892 |
| Molecular Formula | C23H24NO3P |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)heptane-1,6-dione;phosphorosomethane |
| SMILES | CC(=O)CCCCC(=O)N1Cc2ccccc2C#Cc2ccccc21.CP=O |
| InChI | InChI=1S/C22H21NO2.CH3OP/c1-17(24)8-2-7-13-22(25)23-16-20-11-4-3-9-18(20)14-15-19-10-5-6-12-21(19)23;1-3-2/h3-6,9-12H,2,7-8,13,16H2,1H3;1H3 |
| InChIKey | ZIKDACGDDHLZQQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|