C23H21NO4 — CID 157066560
8-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4,8-dioxooctanoic acid (PubChem CID 157066560) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is 8-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4,8-dioxooctanoic acid.
| Compound Name | 8-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4,8-dioxooctanoic acid |
|---|---|
| PubChem CID | 157066560 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 8-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4,8-dioxooctanoic acid |
| SMILES | O=C(O)CCC(=O)CCCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C23H21NO4/c25-20(14-15-23(27)28)9-5-11-22(26)24-16-19-8-2-1-6-17(19)12-13-18-7-3-4-10-21(18)24/h1-4,6-8,10H,5,9,11,14-16H2,(H,27,28) |
| InChIKey | JAFBTORFBSNZFI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|