C23H20F3NO2 — CID 161424521
1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-8,8,8-trifluorooctane-1,7-dione (PubChem CID 161424521) has the molecular formula C23H20F3NO2 and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-8,8,8-trifluorooctane-1,7-dione.
| Compound Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-8,8,8-trifluorooctane-1,7-dione |
|---|---|
| PubChem CID | 161424521 |
| Molecular Formula | C23H20F3NO2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-8,8,8-trifluorooctane-1,7-dione |
| SMILES | O=C(CCCCCC(=O)C(F)(F)F)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C23H20F3NO2/c24-23(25,26)21(28)12-2-1-3-13-22(29)27-16-19-10-5-4-8-17(19)14-15-18-9-6-7-11-20(18)27/h4-11H,1-3,12-13,16H2 |
| InChIKey | UXJJSBMRXBZVSC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|