C30H34N2O3S — CID 170198199
1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-[3-(2,2-dimethyl-6-oxoheptyl)-3-methylthiaziridin-2-yl]butane-1,4-dione (PubChem CID 170198199) has the molecular formula C30H34N2O3S and a molecular weight of 502.68 g/mol. Its IUPAC name is 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-[3-(2,2-dimethyl-6-oxoheptyl)-3-methylthiaziridin-2-yl]butane-1,4-dione.
| Compound Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-[3-(2,2-dimethyl-6-oxoheptyl)-3-methylthiaziridin-2-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 170198199 |
| Molecular Formula | C30H34N2O3S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-[3-(2,2-dimethyl-6-oxoheptyl)-3-methylthiaziridin-2-yl]butane-1,4-dione |
| SMILES | CC(=O)CCCC(C)(C)CC1(C)SN1C(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C30H34N2O3S/c1-22(33)10-9-19-29(2,3)21-30(4)32(36-30)28(35)18-17-27(34)31-20-25-13-6-5-11-23(25)15-16-24-12-7-8-14-26(24)31/h5-8,11-14H,9-10,17-21H2,1-4H3 |
| InChIKey | VYNVYIYBBOCODG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 57.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|