C15H30N2O6 — CID 161049130
ethyl N-ethylcarbamate;2-(4-oxopentoxy)ethyl N-ethylcarbamate (PubChem CID 161049130) has the molecular formula C15H30N2O6 and a molecular weight of 334.41 g/mol. Its IUPAC name is ethyl N-ethylcarbamate;2-(4-oxopentoxy)ethyl N-ethylcarbamate.
| Compound Name | ethyl N-ethylcarbamate;2-(4-oxopentoxy)ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 161049130 |
| Molecular Formula | C15H30N2O6 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | ethyl N-ethylcarbamate;2-(4-oxopentoxy)ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC.CCNC(=O)OCCOCCCC(C)=O |
| InChI | InChI=1S/C10H19NO4.C5H11NO2/c1-3-11-10(13)15-8-7-14-6-4-5-9(2)12;1-3-6-5(7)8-4-2/h3-8H2,1-2H3,(H,11,13);3-4H2,1-2H3,(H,6,7) |
| InChIKey | UBWXCELHXJNVNO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|