C24H23ClN2O4S — CID 161051707
but-2-enedioic acid;8-chloro-6-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine (PubChem CID 161051707) has the molecular formula C24H23ClN2O4S and a molecular weight of 470.98 g/mol. Its IUPAC name is but-2-enedioic acid;8-chloro-6-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine.
| Compound Name | but-2-enedioic acid;8-chloro-6-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 161051707 |
| Molecular Formula | C24H23ClN2O4S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | but-2-enedioic acid;8-chloro-6-(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine |
| SMILES | CCN1CCC=C(C2=Nc3ccccc3Sc3ccc(Cl)cc32)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H19ClN2S.C4H4O4/c1-2-23-11-5-6-14(13-23)20-16-12-15(21)9-10-18(16)24-19-8-4-3-7-17(19)22-20;5-3(6)1-2-4(7)8/h3-4,6-10,12H,2,5,11,13H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | UCFMCUJDFGFHLV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|