C25H26N2O4S — CID 159040270
but-2-enedioic acid;8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine (PubChem CID 159040270) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is but-2-enedioic acid;8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine.
| Compound Name | but-2-enedioic acid;8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 159040270 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | but-2-enedioic acid;8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine |
| SMILES | CCc1ccc2c(c1)C(C1=CCCN(C)C1)=Nc1ccccc1S2.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C21H22N2S.C4H4O4/c1-3-15-10-11-19-17(13-15)21(16-7-6-12-23(2)14-16)22-18-8-4-5-9-20(18)24-19;5-3(6)1-2-4(7)8/h4-5,7-11,13H,3,6,12,14H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JVYQLHOENFHHRC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|