C23H25N3O4S — CID 156619749
(E)-but-2-enedioic acid;6-(4-ethylpiperazin-1-yl)benzo[b][1,4]benzothiazepine (PubChem CID 156619749) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;6-(4-ethylpiperazin-1-yl)benzo[b][1,4]benzothiazepine.
| Compound Name | (E)-but-2-enedioic acid;6-(4-ethylpiperazin-1-yl)benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 156619749 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (E)-but-2-enedioic acid;6-(4-ethylpiperazin-1-yl)benzo[b][1,4]benzothiazepine |
| SMILES | CCN1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H21N3S.C4H4O4/c1-2-21-11-13-22(14-12-21)19-15-7-3-5-9-17(15)23-18-10-6-4-8-16(18)20-19;5-3(6)1-2-4(7)8/h3-10H,2,11-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XKYHPBZGBMQWHK-WLHGVMLRSA-N |
| XLogP | 3.58 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|