C23H28N2O — CID 161056903
(2S)-2,3-dimethyl-1-[(2S)-2-[4-(4-prop-1-ynylphenyl)-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 161056903) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-1-[(2S)-2-[4-(4-prop-1-ynylphenyl)-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | (2S)-2,3-dimethyl-1-[(2S)-2-[4-(4-prop-1-ynylphenyl)-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 161056903 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2S)-2,3-dimethyl-1-[(2S)-2-[4-(4-prop-1-ynylphenyl)-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC#Cc1ccc(C2=CN=C([C@@H]3CCCN3C(=O)[C@@H](C)C(C)C)C2)cc1 |
| InChI | InChI=1S/C23H28N2O/c1-5-7-18-9-11-19(12-10-18)20-14-21(24-15-20)22-8-6-13-25(22)23(26)17(4)16(2)3/h9-12,15-17,22H,6,8,13-14H2,1-4H3/t17-,22-/m0/s1 |
| InChIKey | FTGDJRRDODSCBC-JTSKRJEESA-N |
| XLogP | 4.53 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|