C27H34O10 — CID 161061967
2-[2-(2-carboxyphenoxy)propan-2-yloxy]benzoic acid;decanedioic acid (PubChem CID 161061967) has the molecular formula C27H34O10 and a molecular weight of 518.56 g/mol. Its IUPAC name is 2-[2-(2-carboxyphenoxy)propan-2-yloxy]benzoic acid;decanedioic acid.
| Compound Name | 2-[2-(2-carboxyphenoxy)propan-2-yloxy]benzoic acid;decanedioic acid |
|---|---|
| PubChem CID | 161061967 |
| Molecular Formula | C27H34O10 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[2-(2-carboxyphenoxy)propan-2-yloxy]benzoic acid;decanedioic acid |
| SMILES | CC(C)(Oc1ccccc1C(=O)O)Oc1ccccc1C(=O)O.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H16O6.C10H18O4/c1-17(2,22-13-9-5-3-7-11(13)15(18)19)23-14-10-6-4-8-12(14)16(20)21;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h3-10H,1-2H3,(H,18,19)(H,20,21);1-8H2,(H,11,12)(H,13,14) |
| InChIKey | UDNBAMCHFWALIB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|