C41H56O3S — CID 161063156
1-butyl-3-propoxybenzene;1,3-dipropoxybenzene;1-ethyl-2-(2-ethylphenyl)sulfanylbenzene (PubChem CID 161063156) has the molecular formula C41H56O3S and a molecular weight of 628.96 g/mol. Its IUPAC name is 1-butyl-3-propoxybenzene;1,3-dipropoxybenzene;1-ethyl-2-(2-ethylphenyl)sulfanylbenzene.
| Compound Name | 1-butyl-3-propoxybenzene;1,3-dipropoxybenzene;1-ethyl-2-(2-ethylphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 161063156 |
| Molecular Formula | C41H56O3S |
| Molecular Weight | 628.96 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | 1-butyl-3-propoxybenzene;1,3-dipropoxybenzene;1-ethyl-2-(2-ethylphenyl)sulfanylbenzene |
| SMILES | CCCCc1cccc(OCCC)c1.CCCOc1cccc(OCCC)c1.CCc1ccccc1Sc1ccccc1CC |
| InChI | InChI=1S/C16H18S.C13H20O.C12H18O2/c1-3-13-9-5-7-11-15(13)17-16-12-8-6-10-14(16)4-2;1-3-5-7-12-8-6-9-13(11-12)14-10-4-2;1-3-8-13-11-6-5-7-12(10-11)14-9-4-2/h5-12H,3-4H2,1-2H3;6,8-9,11H,3-5,7,10H2,1-2H3;5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | UDQWFZPMQMWAFC-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.96 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |