C52H116O12Si4 — CID 161065404
tri(butan-2-yloxy)-[2-tri(butan-2-yloxy)silylethyl]silane;tris[(2-methylpropan-2-yl)oxy]-[2-[tris[(2-methylpropan-2-yl)oxy]silyl]ethyl]silane (PubChem CID 161065404) has the molecular formula C52H116O12Si4 and a molecular weight of 1045.83 g/mol. Its IUPAC name is tri(butan-2-yloxy)-[2-tri(butan-2-yloxy)silylethyl]silane;tris[(2-methylpropan-2-yl)oxy]-[2-[tris[(2-methylpropan-2-yl)oxy]silyl]ethyl]silane.
| Compound Name | tri(butan-2-yloxy)-[2-tri(butan-2-yloxy)silylethyl]silane;tris[(2-methylpropan-2-yl)oxy]-[2-[tris[(2-methylpropan-2-yl)oxy]silyl]ethyl]silane |
|---|---|
| PubChem CID | 161065404 |
| Molecular Formula | C52H116O12Si4 |
| Molecular Weight | 1045.83 g/mol |
| Exact Mass | 1044.75 |
| IUPAC Name | tri(butan-2-yloxy)-[2-tri(butan-2-yloxy)silylethyl]silane;tris[(2-methylpropan-2-yl)oxy]-[2-[tris[(2-methylpropan-2-yl)oxy]silyl]ethyl]silane |
| SMILES | CC(C)(C)O[Si](CC[Si](OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C.CCC(C)O[Si](CC[Si](OC(C)CC)(OC(C)CC)OC(C)CC)(OC(C)CC)OC(C)CC |
| InChI | InChI=1S/2C26H58O6Si2/c1-21(2,3)27-33(28-22(4,5)6,29-23(7,8)9)19-20-34(30-24(10,11)12,31-25(13,14)15)32-26(16,17)18;1-13-21(7)27-33(28-22(8)14-2,29-23(9)15-3)19-20-34(30-24(10)16-4,31-25(11)17-5)32-26(12)18-6/h19-20H2,1-18H3;21-26H,13-20H2,1-12H3 |
| InChIKey | UDYNYPVQIHJKQU-UHFFFAOYSA-N |
| XLogP | 15.51 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.83 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|