C13H27FOSi — CID 161066667
tert-butyl-[(1R,2S,4S)-2-fluoro-4-methylcyclohexyl]oxy-dimethylsilane (PubChem CID 161066667) has the molecular formula C13H27FOSi and a molecular weight of 246.44 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,4S)-2-fluoro-4-methylcyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,4S)-2-fluoro-4-methylcyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 161066667 |
| Molecular Formula | C13H27FOSi |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | tert-butyl-[(1R,2S,4S)-2-fluoro-4-methylcyclohexyl]oxy-dimethylsilane |
| SMILES | C[C@H]1CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](F)C1 |
| InChI | InChI=1S/C13H27FOSi/c1-10-7-8-12(11(14)9-10)15-16(5,6)13(2,3)4/h10-12H,7-9H2,1-6H3/t10-,11-,12+/m0/s1 |
| InChIKey | UECMRIMVMNIUPL-SDDRHHMPSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|