C20H38N4S — CID 161067745
1-tert-butylpiperidine-4-carbonitrile;1-tert-butylpiperidine-4-carbothioamide (PubChem CID 161067745) has the molecular formula C20H38N4S and a molecular weight of 366.62 g/mol. Its IUPAC name is 1-tert-butylpiperidine-4-carbonitrile;1-tert-butylpiperidine-4-carbothioamide.
| Compound Name | 1-tert-butylpiperidine-4-carbonitrile;1-tert-butylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 161067745 |
| Molecular Formula | C20H38N4S |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 1-tert-butylpiperidine-4-carbonitrile;1-tert-butylpiperidine-4-carbothioamide |
| SMILES | CC(C)(C)N1CCC(C#N)CC1.CC(C)(C)N1CCC(C(N)=S)CC1 |
| InChI | InChI=1S/C10H20N2S.C10H18N2/c1-10(2,3)12-6-4-8(5-7-12)9(11)13;1-10(2,3)12-6-4-9(8-11)5-7-12/h8H,4-7H2,1-3H3,(H2,11,13);9H,4-7H2,1-3H3 |
| InChIKey | UEGCVCICVJFZCX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|