About 16-methylheptadecan-1-one;titanium(4+);trichloride
16-methylheptadecan-1-one;titanium(4+);trichloride (PubChem CID 161073162) has the molecular formula C18H35Cl3OTi
and a molecular weight of 421.70 g/mol. Its IUPAC name is 16-methylheptadecan-1-one;titanium(4+);trichloride.
Molecular Properties
| Compound Name | 16-methylheptadecan-1-one;titanium(4+);trichloride |
| PubChem CID | 161073162 |
| Molecular Formula | C18H35Cl3OTi |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 16-methylheptadecan-1-one;titanium(4+);trichloride |
| SMILES | CC(C)CCCCCCCCCCCCCC[C-]=O.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C18H35O.3ClH.Ti/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19;;;;/h18H,3-16H2,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | QHGJWQCLEPBAEZ-UHFFFAOYSA-K |
| XLogP | -2.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 16-methylheptadecan-1-one;titanium(4+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-methylheptadecan-1-one;titanium(4+);trichloride?
The IUPAC name of 16-methylheptadecan-1-one;titanium(4+);trichloride (CID 161073162) is 16-methylheptadecan-1-one;titanium(4+);trichloride.
What is the SMILES notation for 16-methylheptadecan-1-one;titanium(4+);trichloride?
The canonical SMILES for 16-methylheptadecan-1-one;titanium(4+);trichloride is CC(C)CCCCCCCCCCCCCC[C-]=O.[Cl-].[Cl-].[Cl-].[Ti+4].
What is the InChIKey of 16-methylheptadecan-1-one;titanium(4+);trichloride?
The InChIKey is QHGJWQCLEPBAEZ-UHFFFAOYSA-K. The full InChI is InChI=1S/C18H35O.3ClH.Ti/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19;;;;/h18H,3-16H2,1-2H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of 16-methylheptadecan-1-one;titanium(4+);trichloride?
16-methylheptadecan-1-one;titanium(4+);trichloride has a molecular weight of 421.70 g/mol, XLogP of -2.78, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 16-methylheptadecan-1-one;titanium(4+);trichloride is sourced from PubChem (CID 161073162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).