C16H31NO3S — CID 161082280
1-[2-(1-tert-butylcyclopropyl)sulfonyl-2-methylpropyl]-3-methoxypyrrolidine (PubChem CID 161082280) has the molecular formula C16H31NO3S and a molecular weight of 317.50 g/mol. Its IUPAC name is 1-[2-(1-tert-butylcyclopropyl)sulfonyl-2-methylpropyl]-3-methoxypyrrolidine.
| Compound Name | 1-[2-(1-tert-butylcyclopropyl)sulfonyl-2-methylpropyl]-3-methoxypyrrolidine |
|---|---|
| PubChem CID | 161082280 |
| Molecular Formula | C16H31NO3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 1-[2-(1-tert-butylcyclopropyl)sulfonyl-2-methylpropyl]-3-methoxypyrrolidine |
| SMILES | COC1CCN(CC(C)(C)S(=O)(=O)C2(C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C16H31NO3S/c1-14(2,3)16(8-9-16)21(18,19)15(4,5)12-17-10-7-13(11-17)20-6/h13H,7-12H2,1-6H3 |
| InChIKey | JAVFGIOYZPCRBY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |