C42H46N4O3 — CID 161083005
5-benzyl-5-azaspiro[2.4]heptane-4,7-dione;5-benzyl-7-[(1R)-1-phenylethyl]imino-5-azaspiro[2.4]heptan-4-one;(1R)-1-phenylethanamine (PubChem CID 161083005) has the molecular formula C42H46N4O3 and a molecular weight of 654.86 g/mol. Its IUPAC name is 5-benzyl-5-azaspiro[2.4]heptane-4,7-dione;5-benzyl-7-[(1R)-1-phenylethyl]imino-5-azaspiro[2.4]heptan-4-one;(1R)-1-phenylethanamine.
| Compound Name | 5-benzyl-5-azaspiro[2.4]heptane-4,7-dione;5-benzyl-7-[(1R)-1-phenylethyl]imino-5-azaspiro[2.4]heptan-4-one;(1R)-1-phenylethanamine |
|---|---|
| PubChem CID | 161083005 |
| Molecular Formula | C42H46N4O3 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.36 |
| IUPAC Name | 5-benzyl-5-azaspiro[2.4]heptane-4,7-dione;5-benzyl-7-[(1R)-1-phenylethyl]imino-5-azaspiro[2.4]heptan-4-one;(1R)-1-phenylethanamine |
| SMILES | C[C@@H](/N=C1\CN(Cc2ccccc2)C(=O)C12CC2)c1ccccc1.C[C@@H](N)c1ccccc1.O=C1CN(Cc2ccccc2)C(=O)C12CC2 |
| InChI | InChI=1S/C21H22N2O.C13H13NO2.C8H11N/c1-16(18-10-6-3-7-11-18)22-19-15-23(20(24)21(19)12-13-21)14-17-8-4-2-5-9-17;15-11-9-14(12(16)13(11)6-7-13)8-10-4-2-1-3-5-10;1-7(9)8-5-3-2-4-6-8/h2-11,16H,12-15H2,1H3;1-5H,6-9H2;2-7H,9H2,1H3/b22-19+;;/t16-;;7-/m1.1/s1 |
| InChIKey | UGDOEKQNLVHYOT-ZCGYVXMHSA-N |
| XLogP | 7.10 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|