C15H28O10 — CID 161085919
3,6-dimethyl-1,4-dioxane-2,5-dione;2-methoxyethanol;2-methoxyethyl 2-hydroxypropanoate (PubChem CID 161085919) has the molecular formula C15H28O10 and a molecular weight of 368.38 g/mol. Its IUPAC name is 3,6-dimethyl-1,4-dioxane-2,5-dione;2-methoxyethanol;2-methoxyethyl 2-hydroxypropanoate.
| Compound Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;2-methoxyethanol;2-methoxyethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 161085919 |
| Molecular Formula | C15H28O10 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3,6-dimethyl-1,4-dioxane-2,5-dione;2-methoxyethanol;2-methoxyethyl 2-hydroxypropanoate |
| SMILES | CC1OC(=O)C(C)OC1=O.COCCO.COCCOC(=O)C(C)O |
| InChI | InChI=1S/C6H8O4.C6H12O4.C3H8O2/c1-3-5(7)10-4(2)6(8)9-3;1-5(7)6(8)10-4-3-9-2;1-5-3-2-4/h3-4H,1-2H3;5,7H,3-4H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | UGMVFKHKXQMJAI-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|