C33H48N4O6 — CID 161087468
4-O-benzyl 1-O-tert-butyl (2R,6S)-2,6-dimethylpiperazine-1,4-dicarboxylate;benzyl (3S,5R)-3,5-dimethylpiperazine-1-carboxylate (PubChem CID 161087468) has the molecular formula C33H48N4O6 and a molecular weight of 596.77 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (2R,6S)-2,6-dimethylpiperazine-1,4-dicarboxylate;benzyl (3S,5R)-3,5-dimethylpiperazine-1-carboxylate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl (2R,6S)-2,6-dimethylpiperazine-1,4-dicarboxylate;benzyl (3S,5R)-3,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 161087468 |
| Molecular Formula | C33H48N4O6 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (2R,6S)-2,6-dimethylpiperazine-1,4-dicarboxylate;benzyl (3S,5R)-3,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H](C)N1.C[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N2O4.C14H20N2O2/c1-14-11-20(17(22)24-13-16-9-7-6-8-10-16)12-15(2)21(14)18(23)25-19(3,4)5;1-11-8-16(9-12(2)15-11)14(17)18-10-13-6-4-3-5-7-13/h6-10,14-15H,11-13H2,1-5H3;3-7,11-12,15H,8-10H2,1-2H3/t14-,15+;11-,12+ |
| InChIKey | UGSFWKLDGYAPSZ-CRVOAERTSA-N |
| XLogP | 5.66 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|