C8H14N2O — CID 161088871
6-methylidene-1-propan-2-yl-1,3-diazinan-4-one (PubChem CID 161088871) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 6-methylidene-1-propan-2-yl-1,3-diazinan-4-one.
| Compound Name | 6-methylidene-1-propan-2-yl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 161088871 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 6-methylidene-1-propan-2-yl-1,3-diazinan-4-one |
| SMILES | C=C1CC(=O)NCN1C(C)C |
| InChI | InChI=1S/C8H14N2O/c1-6(2)10-5-9-8(11)4-7(10)3/h6H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | XXPUFMCTXVXATA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |