C10H12Cl2Os+2 — CID 161089123
2,3-dichloro-1-methyl-4-propan-2-ylbenzene;osmium(2+) (PubChem CID 161089123) has the molecular formula C10H12Cl2Os+2 and a molecular weight of 393.34 g/mol. Its IUPAC name is 2,3-dichloro-1-methyl-4-propan-2-ylbenzene;osmium(2+).
| Compound Name | 2,3-dichloro-1-methyl-4-propan-2-ylbenzene;osmium(2+) |
|---|---|
| PubChem CID | 161089123 |
| Molecular Formula | C10H12Cl2Os+2 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 2,3-dichloro-1-methyl-4-propan-2-ylbenzene;osmium(2+) |
| SMILES | Cc1ccc(C(C)C)c(Cl)c1Cl.[Os+2] |
| InChI | InChI=1S/C10H12Cl2.Os/c1-6(2)8-5-4-7(3)9(11)10(8)12;/h4-6H,1-3H3;/q;+2 |
| InChIKey | UGXXQJDXWJCVKO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |